C25H17F5O3S2 — CID 18629899
2,6-difluoro-4-methylbenzenesulfonate;tris(4-fluorophenyl)sulfanium (PubChem CID 18629899) has the molecular formula C25H17F5O3S2 and a molecular weight of 524.53 g/mol. Its IUPAC name is 2,6-difluoro-4-methylbenzenesulfonate;tris(4-fluorophenyl)sulfanium.
| Compound Name | 2,6-difluoro-4-methylbenzenesulfonate;tris(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 18629899 |
| Molecular Formula | C25H17F5O3S2 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 2,6-difluoro-4-methylbenzenesulfonate;tris(4-fluorophenyl)sulfanium |
| SMILES | Cc1cc(F)c(S(=O)(=O)[O-])c(F)c1.Fc1ccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H12F3S.C7H6F2O3S/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;1-4-2-5(8)7(6(9)3-4)13(10,11)12/h1-12H;2-3H,1H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | UPKPLPBOMYOVCZ-UHFFFAOYSA-M |
| XLogP | 6.38 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|