C12H12F3N3S — CID 18634889
5-N-ethyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-2,5-diimine (PubChem CID 18634889) has the molecular formula C12H12F3N3S and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-N-ethyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-2,5-diimine.
| Compound Name | 5-N-ethyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-2,5-diimine |
|---|---|
| PubChem CID | 18634889 |
| Molecular Formula | C12H12F3N3S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-N-ethyl-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-2,5-diimine |
| SMILES | [H]/N=C1\S/C(=N\CC)CN1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N3S/c1-2-17-10-7-18(11(16)19-10)9-5-3-4-8(6-9)12(13,14)15/h3-6,16H,2,7H2,1H3/b16-11-,17-10- |
| InChIKey | HZVWIFHJUVZBNE-ZTLHOUMVSA-N |
| XLogP | 3.61 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|