C17H9Cl2F3N2OS — CID 16633532
(5Z)-5-[(2,3-dichlorophenyl)methylidene]-2-imino-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 16633532) has the molecular formula C17H9Cl2F3N2OS and a molecular weight of 417.24 g/mol. Its IUPAC name is (5Z)-5-[(2,3-dichlorophenyl)methylidene]-2-imino-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,3-dichlorophenyl)methylidene]-2-imino-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16633532 |
| Molecular Formula | C17H9Cl2F3N2OS |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | (5Z)-5-[(2,3-dichlorophenyl)methylidene]-2-imino-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2cccc(Cl)c2Cl)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9Cl2F3N2OS/c18-12-6-1-3-9(14(12)19)7-13-15(25)24(16(23)26-13)11-5-2-4-10(8-11)17(20,21)22/h1-8,23H/b13-7-,23-16- |
| InChIKey | WVHGUWXQXVCBHE-WQFDACBISA-N |
| XLogP | 6.07 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|