C19H15F4NO — CID 19097808
3-ethyl-4-(3-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one (PubChem CID 19097808) has the molecular formula C19H15F4NO and a molecular weight of 349.33 g/mol. Its IUPAC name is 3-ethyl-4-(3-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one.
| Compound Name | 3-ethyl-4-(3-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 19097808 |
| Molecular Formula | C19H15F4NO |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-ethyl-4-(3-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
| SMILES | CCC1=C(c2cccc(F)c2)C(=O)N(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H15F4NO/c1-2-12-11-24(16-8-4-6-14(10-16)19(21,22)23)18(25)17(12)13-5-3-7-15(20)9-13/h3-10H,2,11H2,1H3 |
| InChIKey | GAHCOYRWBLLYBA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |