C19H24N2O4S — CID 18651857
(6R)-2-hexyl-6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid (PubChem CID 18651857) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is (6R)-2-hexyl-6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid.
| Compound Name | (6R)-2-hexyl-6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid |
|---|---|
| PubChem CID | 18651857 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (6R)-2-hexyl-6-phenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid |
| SMILES | CCCCCCC1=CN2C[C@@H](c3ccccc3)N=C2S1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H22N2S.C2H2O4/c1-2-3-4-8-11-15-12-19-13-16(18-17(19)20-15)14-9-6-5-7-10-14;3-1(4)2(5)6/h5-7,9-10,12,16H,2-4,8,11,13H2,1H3;(H,3,4)(H,5,6)/t16-;/m0./s1 |
| InChIKey | SVTNFVYWKXNABL-NTISSMGPSA-N |
| XLogP | 4.11 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|