C35H42FN3O8 — CID 18654212
[4-[5-(5-heptyl-1,3-dioxan-2-yl)-2-pyridinyl]phenyl] 2-amino-4-[(2R)-2-fluorohexanoyl]oxy-5-nitrobenzoate (PubChem CID 18654212) has the molecular formula C35H42FN3O8 and a molecular weight of 651.73 g/mol. Its IUPAC name is [4-[5-(5-heptyl-1,3-dioxan-2-yl)-2-pyridinyl]phenyl] 2-amino-4-[(2R)-2-fluorohexanoyl]oxy-5-nitrobenzoate.
| Compound Name | [4-[5-(5-heptyl-1,3-dioxan-2-yl)-2-pyridinyl]phenyl] 2-amino-4-[(2R)-2-fluorohexanoyl]oxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 18654212 |
| Molecular Formula | C35H42FN3O8 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | [4-[5-(5-heptyl-1,3-dioxan-2-yl)-2-pyridinyl]phenyl] 2-amino-4-[(2R)-2-fluorohexanoyl]oxy-5-nitrobenzoate |
| SMILES | CCCCCCCC1COC(c2ccc(-c3ccc(OC(=O)c4cc([N+](=O)[O-])c(OC(=O)[C@H](F)CCCC)cc4N)cc3)nc2)OC1 |
| InChI | InChI=1S/C35H42FN3O8/c1-3-5-7-8-9-10-23-21-44-35(45-22-23)25-14-17-30(38-20-25)24-12-15-26(16-13-24)46-33(40)27-18-31(39(42)43)32(19-29(27)37)47-34(41)28(36)11-6-4-2/h12-20,23,28,35H,3-11,21-22,37H2,1-2H3/t23?,28-,35?/m1/s1 |
| InChIKey | FUTSBCXFAHKSIC-AHROLGEKSA-N |
| XLogP | 7.91 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|