C30H37FN2O8 — CID 18654229
[4-[5-[(E)-hept-1-enyl]-1,3-dioxan-2-yl]phenyl] 5-amino-4-[(2R)-2-fluorohexanoyl]oxy-2-nitrobenzoate (PubChem CID 18654229) has the molecular formula C30H37FN2O8 and a molecular weight of 572.63 g/mol. Its IUPAC name is [4-[5-[(E)-hept-1-enyl]-1,3-dioxan-2-yl]phenyl] 5-amino-4-[(2R)-2-fluorohexanoyl]oxy-2-nitrobenzoate.
| Compound Name | [4-[5-[(E)-hept-1-enyl]-1,3-dioxan-2-yl]phenyl] 5-amino-4-[(2R)-2-fluorohexanoyl]oxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 18654229 |
| Molecular Formula | C30H37FN2O8 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | [4-[5-[(E)-hept-1-enyl]-1,3-dioxan-2-yl]phenyl] 5-amino-4-[(2R)-2-fluorohexanoyl]oxy-2-nitrobenzoate |
| SMILES | CCCCC/C=C/C1COC(c2ccc(OC(=O)c3cc(N)c(OC(=O)[C@H](F)CCCC)cc3[N+](=O)[O-])cc2)OC1 |
| InChI | InChI=1S/C30H37FN2O8/c1-3-5-7-8-9-10-20-18-38-30(39-19-20)21-12-14-22(15-13-21)40-28(34)23-16-25(32)27(17-26(23)33(36)37)41-29(35)24(31)11-6-4-2/h9-10,12-17,20,24,30H,3-8,11,18-19,32H2,1-2H3/b10-9+/t20?,24-,30?/m1/s1 |
| InChIKey | DNWYLWAUEPNZAU-RRXKXTKKSA-N |
| XLogP | 6.63 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|