C17H26F3N3O3S — CID 18655306
(2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzylpentanamide;2,2,2-trifluoroacetic acid (PubChem CID 18655306) has the molecular formula C17H26F3N3O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzylpentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzylpentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18655306 |
| Molecular Formula | C17H26F3N3O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-benzylpentanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC[C@H](NC[C@@H](N)CS)C(=O)NCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3OS.C2HF3O2/c1-2-6-14(17-10-13(16)11-20)15(19)18-9-12-7-4-3-5-8-12;3-2(4,5)1(6)7/h3-5,7-8,13-14,17,20H,2,6,9-11,16H2,1H3,(H,18,19);(H,6,7)/t13-,14+;/m1./s1 |
| InChIKey | GMDTZIPLKYDEEP-DFQHDRSWSA-N |
| XLogP | 1.95 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|