C17H19N5O — CID 18659372
(7R)-3-benzyl-2,5,7-trimethyl-7,8-dihydroimidazo[2,1-b]purin-4-one (PubChem CID 18659372) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (7R)-3-benzyl-2,5,7-trimethyl-7,8-dihydroimidazo[2,1-b]purin-4-one.
| Compound Name | (7R)-3-benzyl-2,5,7-trimethyl-7,8-dihydroimidazo[2,1-b]purin-4-one |
|---|---|
| PubChem CID | 18659372 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (7R)-3-benzyl-2,5,7-trimethyl-7,8-dihydroimidazo[2,1-b]purin-4-one |
| SMILES | Cc1nc2c(n1Cc1ccccc1)C(=O)N(C)C1=N[C@H](C)CN12 |
| InChI | InChI=1S/C17H19N5O/c1-11-9-22-15-14(16(23)20(3)17(22)18-11)21(12(2)19-15)10-13-7-5-4-6-8-13/h4-8,11H,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | IEPMPAZHBXLCOP-LLVKDONJSA-N |
| XLogP | 1.89 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |