C19H17Cl2NO4 — CID 18677172
2-[2-(3,4-dichlorophenyl)-5-oxomorpholin-2-yl]ethyl benzoate (PubChem CID 18677172) has the molecular formula C19H17Cl2NO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-5-oxomorpholin-2-yl]ethyl benzoate.
| Compound Name | 2-[2-(3,4-dichlorophenyl)-5-oxomorpholin-2-yl]ethyl benzoate |
|---|---|
| PubChem CID | 18677172 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-5-oxomorpholin-2-yl]ethyl benzoate |
| SMILES | O=C1COC(CCOC(=O)c2ccccc2)(c2ccc(Cl)c(Cl)c2)CN1 |
| InChI | InChI=1S/C19H17Cl2NO4/c20-15-7-6-14(10-16(15)21)19(12-22-17(23)11-26-19)8-9-25-18(24)13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,22,23) |
| InChIKey | YIXCFZXYRRJZMU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |