C25H33F3O2 — CID 18689218
1-[4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexyl]-4-(trifluoromethoxy)benzene (PubChem CID 18689218) has the molecular formula C25H33F3O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexyl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexyl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 18689218 |
| Molecular Formula | C25H33F3O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[4-[4-[(2E,4E)-hexa-2,4-dienoxy]cyclohexyl]cyclohexyl]-4-(trifluoromethoxy)benzene |
| SMILES | C/C=C/C=C/COC1CCC(C2CCC(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H33F3O2/c1-2-3-4-5-18-29-23-14-10-21(11-15-23)19-6-8-20(9-7-19)22-12-16-24(17-13-22)30-25(26,27)28/h2-5,12-13,16-17,19-21,23H,6-11,14-15,18H2,1H3/b3-2+,5-4+ |
| InChIKey | HLHHKBVXPYDTPK-MQQKCMAXSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|