C25H30F3NO3 — CID 145030951
2,3,6-trimethyl-4-prop-2-enoxy-5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]pyridine (PubChem CID 145030951) has the molecular formula C25H30F3NO3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2,3,6-trimethyl-4-prop-2-enoxy-5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]pyridine.
| Compound Name | 2,3,6-trimethyl-4-prop-2-enoxy-5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 145030951 |
| Molecular Formula | C25H30F3NO3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2,3,6-trimethyl-4-prop-2-enoxy-5-[[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxymethyl]pyridine |
| SMILES | C=CCOc1c(C)c(C)nc(C)c1COC1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H30F3NO3/c1-5-14-30-24-16(2)17(3)29-18(4)23(24)15-31-21-10-6-19(7-11-21)20-8-12-22(13-9-20)32-25(26,27)28/h5,8-9,12-13,19,21H,1,6-7,10-11,14-15H2,2-4H3 |
| InChIKey | XKUFKQPYZRTOAD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|