About chloro-bis(2,6-dichlorophenyl)phosphane
chloro-bis(2,6-dichlorophenyl)phosphane (PubChem CID 18705983) has the molecular formula C12H6Cl5P
and a molecular weight of 358.42 g/mol. Its IUPAC name is chloro-bis(2,6-dichlorophenyl)phosphane.
Molecular Properties
| Compound Name | chloro-bis(2,6-dichlorophenyl)phosphane |
|---|
| PubChem CID | 18705983 |
|---|
| Molecular Formula | C12H6Cl5P |
|---|
| Molecular Weight | 358.42 g/mol |
|---|
| Exact Mass | 355.86 |
|---|
| IUPAC Name | chloro-bis(2,6-dichlorophenyl)phosphane |
|---|
| SMILES | Clc1cccc(Cl)c1P(Cl)c1c(Cl)cccc1Cl |
|---|
| InChI | InChI=1S/C12H6Cl5P/c13-7-3-1-4-8(14)11(7)18(17)12-9(15)5-2-6-10(12)16/h1-6H |
|---|
| InChIKey | NYHNZFULTLGFBL-UHFFFAOYSA-N |
|---|
| XLogP | 5.89 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 18 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-bis(2,6-dichlorophenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-bis(2,6-dichlorophenyl)phosphane?
The IUPAC name of chloro-bis(2,6-dichlorophenyl)phosphane (CID 18705983) is chloro-bis(2,6-dichlorophenyl)phosphane.
What is the SMILES notation for chloro-bis(2,6-dichlorophenyl)phosphane?
The canonical SMILES for chloro-bis(2,6-dichlorophenyl)phosphane is Clc1cccc(Cl)c1P(Cl)c1c(Cl)cccc1Cl.
What is the InChIKey of chloro-bis(2,6-dichlorophenyl)phosphane?
The InChIKey is NYHNZFULTLGFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl5P/c13-7-3-1-4-8(14)11(7)18(17)12-9(15)5-2-6-10(12)16/h1-6H.
What are the key properties of chloro-bis(2,6-dichlorophenyl)phosphane?
chloro-bis(2,6-dichlorophenyl)phosphane has a molecular weight of 358.42 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-bis(2,6-dichlorophenyl)phosphane is sourced from PubChem (CID 18705983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).