C16H10N6O3S2 — CID 18708122
5-nitro-2-[1-(4-phenoxyphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole (PubChem CID 18708122) has the molecular formula C16H10N6O3S2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 5-nitro-2-[1-(4-phenoxyphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole.
| Compound Name | 5-nitro-2-[1-(4-phenoxyphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 18708122 |
| Molecular Formula | C16H10N6O3S2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 5-nitro-2-[1-(4-phenoxyphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cnc(Sc2nnnn2-c2ccc(Oc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C16H10N6O3S2/c23-22(24)14-10-17-16(26-14)27-15-18-19-20-21(15)11-6-8-13(9-7-11)25-12-4-2-1-3-5-12/h1-10H |
| InChIKey | MZNPHWRQLDQNNZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|