About 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane
1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane (PubChem CID 18711519) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane.
Analyze 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane?
The IUPAC name of 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane (CID 18711519) is 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane.
What is the SMILES notation for 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane?
The canonical SMILES for 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane is CN1CCCC2C3CCC(C)(C21)C3(C)C.
What is the InChIKey of 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane?
The InChIKey is ZSUGZVVMAZAQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-13(2)11-7-8-14(13,3)12-10(11)6-5-9-15(12)4/h10-12H,5-9H2,1-4H3.
What are the key properties of 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane?
1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane has a molecular weight of 207.36 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,11,11-tetramethyl-3-azatricyclo[6.2.1.02,7]undecane is sourced from PubChem (CID 18711519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).