C15H23NO3S — CID 134920643
(1S,2R,6S,7R)-7,10,10-trimethyl-5-[(3S)-3-sulfanylbutanoyl]-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 134920643) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is (1S,2R,6S,7R)-7,10,10-trimethyl-5-[(3S)-3-sulfanylbutanoyl]-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1S,2R,6S,7R)-7,10,10-trimethyl-5-[(3S)-3-sulfanylbutanoyl]-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 134920643 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1S,2R,6S,7R)-7,10,10-trimethyl-5-[(3S)-3-sulfanylbutanoyl]-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | C[C@H](S)CC(=O)N1C(=O)O[C@@H]2[C@H]3CC[C@@](C)([C@@H]21)C3(C)C |
| InChI | InChI=1S/C15H23NO3S/c1-8(20)7-10(17)16-12-11(19-13(16)18)9-5-6-15(12,4)14(9,2)3/h8-9,11-12,20H,5-7H2,1-4H3/t8-,9+,11+,12+,15-/m0/s1 |
| InChIKey | LYQMWZPVPPDFKF-UGCTXDRPSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|