C23H29NO4 — CID 100995553
(1S,2R,6S,7R)-7,10,10-trimethyl-5-(3-methyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carbonyl)-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 100995553) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (1S,2R,6S,7R)-7,10,10-trimethyl-5-(3-methyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carbonyl)-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1S,2R,6S,7R)-7,10,10-trimethyl-5-(3-methyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carbonyl)-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 100995553 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (1S,2R,6S,7R)-7,10,10-trimethyl-5-(3-methyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carbonyl)-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | CC1=C(C(=O)N2C(=O)O[C@@H]3[C@H]4CC[C@@](C)([C@@H]32)C4(C)C)C(=O)C2C3CCC(C3)C12 |
| InChI | InChI=1S/C23H29NO4/c1-10-14-11-5-6-12(9-11)16(14)17(25)15(10)20(26)24-19-18(28-21(24)27)13-7-8-23(19,4)22(13,2)3/h11-14,16,18-19H,5-9H2,1-4H3/t11?,12?,13-,14?,16?,18-,19-,23+/m1/s1 |
| InChIKey | NOXSPFJPIDQMKC-IIEZMPBTSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|