C21H21N3O3S — CID 18719137
phenyl (NE)-N-[[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylidene]sulfamate (PubChem CID 18719137) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is phenyl (NE)-N-[[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylidene]sulfamate.
| Compound Name | phenyl (NE)-N-[[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylidene]sulfamate |
|---|---|
| PubChem CID | 18719137 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | phenyl (NE)-N-[[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylidene]sulfamate |
| SMILES | Cc1cc(C)c(/N=C/C2=CCC(/C=N/S(=O)(=O)Oc3ccccc3)=N2)c(C)c1 |
| InChI | InChI=1S/C21H21N3O3S/c1-15-11-16(2)21(17(3)12-15)22-13-18-9-10-19(24-18)14-23-28(25,26)27-20-7-5-4-6-8-20/h4-9,11-14H,10H2,1-3H3/b22-13+,23-14+ |
| InChIKey | KKSFPWHYGPQXJE-MSKUYSOUSA-N |
| XLogP | 4.44 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|