C19H28Cl2FeN5P — CID 18719500
dichloroiron;N-[dimethylamino-[(E)-[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylideneamino]phosphanyl]-N-methylmethanamine (PubChem CID 18719500) has the molecular formula C19H28Cl2FeN5P and a molecular weight of 484.19 g/mol. Its IUPAC name is dichloroiron;N-[dimethylamino-[(E)-[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylideneamino]phosphanyl]-N-methylmethanamine.
| Compound Name | dichloroiron;N-[dimethylamino-[(E)-[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylideneamino]phosphanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 18719500 |
| Molecular Formula | C19H28Cl2FeN5P |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | dichloroiron;N-[dimethylamino-[(E)-[5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methylideneamino]phosphanyl]-N-methylmethanamine |
| SMILES | Cc1cc(C)c(/N=C/C2=CCC(/C=N/P(N(C)C)N(C)C)=N2)c(C)c1.Cl[Fe]Cl |
| InChI | InChI=1S/C19H28N5P.2ClH.Fe/c1-14-10-15(2)19(16(3)11-14)20-12-17-8-9-18(22-17)13-21-25(23(4)5)24(6)7;;;/h8,10-13H,9H2,1-7H3;2*1H;/q;;;+2/p-2/b20-12+,21-13+;;; |
| InChIKey | ZNKXCCLVJSKCBN-LSLBEZLLSA-L |
| XLogP | 5.84 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|