C26H40Ac2O9 — CID 18720275
actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-methylbutanoate (PubChem CID 18720275) has the molecular formula C26H40Ac2O9 and a molecular weight of 950.60 g/mol. Its IUPAC name is actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-methylbutanoate.
| Compound Name | actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 18720275 |
| Molecular Formula | C26H40Ac2O9 |
| Molecular Weight | 950.60 g/mol |
| Exact Mass | 950.32 |
| IUPAC Name | actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-methylbutanoate |
| SMILES | CC1=C2C(O)C(=O)C3(C)C(O)CC4OCC4(O)C3C(C)C(O)(CC1OC(=O)C(O)C(C)C)C2(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C26H40O9.2Ac/c1-11(2)18(28)22(31)35-14-9-26(33)13(4)20-24(7,15(27)8-16-25(20,32)10-34-16)21(30)19(29)17(12(14)3)23(26,5)6;;/h11,13-16,18-20,27-29,32-33H,8-10H2,1-7H3;; |
| InChIKey | KMHGONPOEPODRP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.60 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|