C10H19NO5 — CID 18721114
N-(2-methoxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide (PubChem CID 18721114) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 18721114 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-[2-(2-oxopropoxy)ethoxy]acetamide |
| SMILES | COCCNC(=O)COCCOCC(C)=O |
| InChI | InChI=1S/C10H19NO5/c1-9(12)7-15-5-6-16-8-10(13)11-3-4-14-2/h3-8H2,1-2H3,(H,11,13) |
| InChIKey | NZDRYFOYNCHHTI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|