C11H21O2Y+2 — CID 18731035
2,3-dimethylbutan-2-yl 2-methylbutanoate;yttrium(3+) (PubChem CID 18731035) has the molecular formula C11H21O2Y+2 and a molecular weight of 274.19 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 2-methylbutanoate;yttrium(3+).
| Compound Name | 2,3-dimethylbutan-2-yl 2-methylbutanoate;yttrium(3+) |
|---|---|
| PubChem CID | 18731035 |
| Molecular Formula | C11H21O2Y+2 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2,3-dimethylbutan-2-yl 2-methylbutanoate;yttrium(3+) |
| SMILES | CC[C-](C)C(=O)OC(C)(C)C(C)C.[Y+3] |
| InChI | InChI=1S/C11H21O2.Y/c1-7-9(4)10(12)13-11(5,6)8(2)3;/h8H,7H2,1-6H3;/q-1;+3 |
| InChIKey | ZEQZRPPWAGAXJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|