C20H36O4S — CID 18736975
1-[1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 18736975) has the molecular formula C20H36O4S and a molecular weight of 372.57 g/mol. Its IUPAC name is 1-[1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | 1-[1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 18736975 |
| Molecular Formula | C20H36O4S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-[1-(4-tert-butylsulfonylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(OCCCCS(=O)(=O)C(C)(C)C)C1CCC2C(=O)CCCC21C |
| InChI | InChI=1S/C20H36O4S/c1-15(24-13-6-7-14-25(22,23)19(2,3)4)16-10-11-17-18(21)9-8-12-20(16,17)5/h15-17H,6-14H2,1-5H3 |
| InChIKey | IYCUSPHMWATCOJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|