About bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+)
bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) (PubChem CID 18740562) has the molecular formula C16H16N2O2Y+
and a molecular weight of 357.22 g/mol. Its IUPAC name is bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+).
Molecular Properties
| Compound Name | bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) |
| PubChem CID | 18740562 |
| Molecular Formula | C16H16N2O2Y+ |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) |
| SMILES | CC(=[N-])c1ccccc1O.CC(=[N-])c1ccccc1O.[Y+3] |
| InChI | InChI=1S/2C8H8NO.Y/c2*1-6(9)7-4-2-3-5-8(7)10;/h2*2-5,10H,1H3;/q2*-1;+3 |
| InChIKey | IJXUMJQRUAQMJV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+)?
The IUPAC name of bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) (CID 18740562) is bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+).
What is the SMILES notation for bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+)?
The canonical SMILES for bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) is CC(=[N-])c1ccccc1O.CC(=[N-])c1ccccc1O.[Y+3].
What is the InChIKey of bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+)?
The InChIKey is IJXUMJQRUAQMJV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8NO.Y/c2*1-6(9)7-4-2-3-5-8(7)10;/h2*2-5,10H,1H3;/q2*-1;+3.
What are the key properties of bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+)?
bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) has a molecular weight of 357.22 g/mol, XLogP of 3.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-(2-hydroxyphenyl)ethylideneazanide);yttrium(3+) is sourced from PubChem (CID 18740562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).