C24H38N8O7 — CID 18745629
2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18745629) has the molecular formula C24H38N8O7 and a molecular weight of 550.62 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18745629 |
| Molecular Formula | C24H38N8O7 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H38N8O7/c1-13(33)19(26)22(37)31-15(8-5-11-29-24(27)28)20(35)30-16(9-10-18(25)34)21(36)32-17(23(38)39)12-14-6-3-2-4-7-14/h2-4,6-7,13,15-17,19,33H,5,8-12,26H2,1H3,(H2,25,34)(H,30,35)(H,31,37)(H,32,36)(H,38,39)(H4,27,28,29) |
| InChIKey | AZBGLFQZILEIHC-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|