C32H31F2N7O3S — CID 18756087
1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]-3-naphthalen-1-ylsulfanylurea (PubChem CID 18756087) has the molecular formula C32H31F2N7O3S and a molecular weight of 631.71 g/mol. Its IUPAC name is 1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]-3-naphthalen-1-ylsulfanylurea.
| Compound Name | 1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]-3-naphthalen-1-ylsulfanylurea |
|---|---|
| PubChem CID | 18756087 |
| Molecular Formula | C32H31F2N7O3S |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]-3-naphthalen-1-ylsulfanylurea |
| SMILES | O=C(NSc1cccc2ccccc12)NN1CCN(c2ccc(OCC(O)(Cn3cncn3)c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C32H31F2N7O3S/c33-24-8-13-28(29(34)18-24)32(43,19-41-22-35-21-36-41)20-44-26-11-9-25(10-12-26)39-14-16-40(17-15-39)37-31(42)38-45-30-7-3-5-23-4-1-2-6-27(23)30/h1-13,18,21-22,43H,14-17,19-20H2,(H2,37,38,42) |
| InChIKey | QZGPTCLBKLQRGF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|