C28H27Cl2F2N7O3 — CID 18756100
1-(2,4-dichlorophenyl)-3-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea (PubChem CID 18756100) has the molecular formula C28H27Cl2F2N7O3 and a molecular weight of 618.47 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea |
|---|---|
| PubChem CID | 18756100 |
| Molecular Formula | C28H27Cl2F2N7O3 |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)NN1CCN(c2ccc(OCC(O)(Cn3cncn3)c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C28H27Cl2F2N7O3/c29-19-1-8-26(24(30)13-19)35-27(40)36-38-11-9-37(10-12-38)21-3-5-22(6-4-21)42-16-28(41,15-39-18-33-17-34-39)23-7-2-20(31)14-25(23)32/h1-8,13-14,17-18,41H,9-12,15-16H2,(H2,35,36,40) |
| InChIKey | VDSKQSPPXPYRGQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|