C30H34Cl2N7O2+ — CID 19830013
[4-[4-[4-[2-(2,4-dichlorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]anilino]methylidene-dimethylazanium (PubChem CID 19830013) has the molecular formula C30H34Cl2N7O2+ and a molecular weight of 595.56 g/mol. Its IUPAC name is [4-[4-[4-[2-(2,4-dichlorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]anilino]methylidene-dimethylazanium.
| Compound Name | [4-[4-[4-[2-(2,4-dichlorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]anilino]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 19830013 |
| Molecular Formula | C30H34Cl2N7O2+ |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | [4-[4-[4-[2-(2,4-dichlorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]anilino]methylidene-dimethylazanium |
| SMILES | C[N+](C)=CNc1ccc(N2CCN(c3ccc(OCC(O)(Cn4cncn4)c4ccc(Cl)cc4Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H33Cl2N7O2/c1-36(2)22-34-24-4-6-25(7-5-24)37-13-15-38(16-14-37)26-8-10-27(11-9-26)41-19-30(40,18-39-21-33-20-35-39)28-12-3-23(31)17-29(28)32/h3-12,17,20-22,40H,13-16,18-19H2,1-2H3/p+1 |
| InChIKey | KLNSYJZCAXPOJO-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|