C28H28ClF2N7O3 — CID 70026905
1-(4-chlorophenyl)-1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea (PubChem CID 70026905) has the molecular formula C28H28ClF2N7O3 and a molecular weight of 584.03 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea |
|---|---|
| PubChem CID | 70026905 |
| Molecular Formula | C28H28ClF2N7O3 |
| Molecular Weight | 584.03 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 1-(4-chlorophenyl)-1-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]piperazin-1-yl]urea |
| SMILES | NC(=O)N(c1ccc(Cl)cc1)N1CCN(c2ccc(OCC(O)(Cn3cncn3)c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C28H28ClF2N7O3/c29-20-1-4-23(5-2-20)38(27(32)39)37-13-11-35(12-14-37)22-6-8-24(9-7-22)41-17-28(40,16-36-19-33-18-34-36)25-10-3-21(30)15-26(25)31/h1-10,15,18-19,40H,11-14,16-17H2,(H2,32,39) |
| InChIKey | BVJXSMKJNFXCHT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.03 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|