C33H62O4P2 — CID 18757143
3-[3-[3-[3,3-bis(3-hydroxycyclohexyl)propylphosphanyl]propylphosphanyl]-1-(3-hydroxycyclohexyl)propyl]cyclohexan-1-ol (PubChem CID 18757143) has the molecular formula C33H62O4P2 and a molecular weight of 584.80 g/mol. Its IUPAC name is 3-[3-[3-[3,3-bis(3-hydroxycyclohexyl)propylphosphanyl]propylphosphanyl]-1-(3-hydroxycyclohexyl)propyl]cyclohexan-1-ol.
| Compound Name | 3-[3-[3-[3,3-bis(3-hydroxycyclohexyl)propylphosphanyl]propylphosphanyl]-1-(3-hydroxycyclohexyl)propyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 18757143 |
| Molecular Formula | C33H62O4P2 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | 3-[3-[3-[3,3-bis(3-hydroxycyclohexyl)propylphosphanyl]propylphosphanyl]-1-(3-hydroxycyclohexyl)propyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(C(CCPCCCPCCC(C2CCCC(O)C2)C2CCCC(O)C2)C2CCCC(O)C2)C1 |
| InChI | InChI=1S/C33H62O4P2/c34-28-10-1-6-24(20-28)32(25-7-2-11-29(35)21-25)14-18-38-16-5-17-39-19-15-33(26-8-3-12-30(36)22-26)27-9-4-13-31(37)23-27/h24-39H,1-23H2 |
| InChIKey | WNLSRIJVJWOUBI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|