C10H10ClN3S — CID 18770699
methyl N'-[(2-chlorophenyl)methyl]-N-cyanocarbamimidothioate (PubChem CID 18770699) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is methyl N'-[(2-chlorophenyl)methyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[(2-chlorophenyl)methyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 18770699 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | methyl N'-[(2-chlorophenyl)methyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\Cc1ccccc1Cl)NC#N |
| InChI | InChI=1S/C10H10ClN3S/c1-15-10(14-7-12)13-6-8-4-2-3-5-9(8)11/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | MTMMBRXLJQWTGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|