C24H11N3O7S — CID 18788010
19-nitro-3,10-dioxo-15,26-diazahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1,4,6,8,11,13,15,17(22),18,20,23,25-dodecaene-13-sulfonic acid (PubChem CID 18788010) has the molecular formula C24H11N3O7S and a molecular weight of 485.43 g/mol. Its IUPAC name is 19-nitro-3,10-dioxo-15,26-diazahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1,4,6,8,11,13,15,17(22),18,20,23,25-dodecaene-13-sulfonic acid.
| Compound Name | 19-nitro-3,10-dioxo-15,26-diazahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1,4,6,8,11,13,15,17(22),18,20,23,25-dodecaene-13-sulfonic acid |
|---|---|
| PubChem CID | 18788010 |
| Molecular Formula | C24H11N3O7S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 19-nitro-3,10-dioxo-15,26-diazahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1,4,6,8,11,13,15,17(22),18,20,23,25-dodecaene-13-sulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)O)c1nc3c(ccc4ccc([N+](=O)[O-])cc43)nc21 |
| InChI | InChI=1S/C24H11N3O7S/c28-23-13-3-1-2-4-14(13)24(29)19-16(23)10-18(35(32,33)34)21-22(19)25-17-8-6-11-5-7-12(27(30)31)9-15(11)20(17)26-21/h1-10H,(H,32,33,34) |
| InChIKey | XPBIAVOQJAPCDJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|