C13H10N2O4S — CID 18809133
(2Z)-N-(4-acetylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide (PubChem CID 18809133) has the molecular formula C13H10N2O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is (2Z)-N-(4-acetylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide.
| Compound Name | (2Z)-N-(4-acetylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
|---|---|
| PubChem CID | 18809133 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (2Z)-N-(4-acetylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)/C=C2\SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C13H10N2O4S/c1-7(16)8-2-4-9(5-3-8)14-11(17)6-10-12(18)15-13(19)20-10/h2-6H,1H3,(H,14,17)(H,15,18,19)/b10-6- |
| InChIKey | CBGWHPXGMAHDJR-POHAHGRESA-N |
| XLogP | 1.69 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|