C11H8N2O3S2 — CID 4737190
2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-sulfanylphenyl)acetamide (PubChem CID 4737190) has the molecular formula C11H8N2O3S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-sulfanylphenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 4737190 |
| Molecular Formula | C11H8N2O3S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-sulfanylphenyl)acetamide |
| SMILES | O=C(C=C1SC(=O)NC1=O)Nc1ccccc1S |
| InChI | InChI=1S/C11H8N2O3S2/c14-9(5-8-10(15)13-11(16)18-8)12-6-3-1-2-4-7(6)17/h1-5,17H,(H,12,14)(H,13,15,16) |
| InChIKey | MLXTUFAXCFNIDQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|