C17H21N7O2 — CID 18835439
(4Z)-N,N-bis(cyanomethyl)-4-(diaminomethylidenehydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835439) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is (4Z)-N,N-bis(cyanomethyl)-4-(diaminomethylidenehydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-N,N-bis(cyanomethyl)-4-(diaminomethylidenehydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835439 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (4Z)-N,N-bis(cyanomethyl)-4-(diaminomethylidenehydrazinylidene)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N(CC#N)CC#N)oc2c1/C(=N\N=C(N)N)CC(C)(C)C2 |
| InChI | InChI=1S/C17H21N7O2/c1-10-13-11(22-23-16(20)21)8-17(2,3)9-12(13)26-14(10)15(25)24(6-4-18)7-5-19/h6-9H2,1-3H3,(H4,20,21,23)/b22-11- |
| InChIKey | MHTJHTHJHWEADA-JJFYIABZSA-N |
| XLogP | 1.03 |
| TPSA | 157.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|