C24H17FN2O3S — CID 18846578
3-[[(5Z)-5-[1-(4-fluorophenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846578) has the molecular formula C24H17FN2O3S and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-[[(5Z)-5-[1-(4-fluorophenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[1-(4-fluorophenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846578 |
| Molecular Formula | C24H17FN2O3S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-[[(5Z)-5-[1-(4-fluorophenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | C/C(=C1/S/C(=N\c2cccc(C(=O)O)c2)N(c2ccccc2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H17FN2O3S/c1-15(16-10-12-18(25)13-11-16)21-22(28)27(20-8-3-2-4-9-20)24(31-21)26-19-7-5-6-17(14-19)23(29)30/h2-14H,1H3,(H,29,30)/b21-15-,26-24- |
| InChIKey | VOQPFHCAOYMABQ-BNUIPMERSA-N |
| XLogP | 5.72 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|