C24H18N2O4S — CID 18846579
3-[[(5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846579) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-[[(5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846579 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-[[(5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | C/C(=C1/S/C(=N\c2cccc(C(=O)O)c2)N(c2ccccc2)C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H18N2O4S/c1-15(16-10-12-20(27)13-11-16)21-22(28)26(19-8-3-2-4-9-19)24(31-21)25-18-7-5-6-17(14-18)23(29)30/h2-14,27H,1H3,(H,29,30)/b21-15-,25-24- |
| InChIKey | NBBJIAXGZLQJGT-PSYZWBJOSA-N |
| XLogP | 5.29 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|