C26H22N2O3S — CID 18846580
3-[[(5Z)-5-[1-(3,4-dimethylphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846580) has the molecular formula C26H22N2O3S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[[(5Z)-5-[1-(3,4-dimethylphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[1-(3,4-dimethylphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846580 |
| Molecular Formula | C26H22N2O3S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[[(5Z)-5-[1-(3,4-dimethylphenyl)ethylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | C/C(=C1/S/C(=N\c2cccc(C(=O)O)c2)N(c2ccccc2)C1=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H22N2O3S/c1-16-12-13-19(14-17(16)2)18(3)23-24(29)28(22-10-5-4-6-11-22)26(32-23)27-21-9-7-8-20(15-21)25(30)31/h4-15H,1-3H3,(H,30,31)/b23-18-,27-26- |
| InChIKey | ZNEJYVVOQKQHDP-MELLALHUSA-N |
| XLogP | 6.20 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|