C21H18N4OS2 — CID 18845090
(2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(4-methyl-1,3-thiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 18845090) has the molecular formula C21H18N4OS2 and a molecular weight of 406.54 g/mol. Its IUPAC name is (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(4-methyl-1,3-thiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(4-methyl-1,3-thiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18845090 |
| Molecular Formula | C21H18N4OS2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (2E,5Z)-5-[1-(3-aminophenyl)ethylidene]-2-[(4-methyl-1,3-thiazol-2-yl)imino]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | C/C(=C1/S/C(=N/c2nc(C)cs2)N(c2ccccc2)C1=O)c1cccc(N)c1 |
| InChI | InChI=1S/C21H18N4OS2/c1-13-12-27-20(23-13)24-21-25(17-9-4-3-5-10-17)19(26)18(28-21)14(2)15-7-6-8-16(22)11-15/h3-12H,22H2,1-2H3/b18-14-,24-21+ |
| InChIKey | DAOCMQGTAUXQQI-FGJAPUQFSA-N |
| XLogP | 5.23 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|