C22H13Cl3F3NO5S — CID 18923170
(2,4,6-trichlorophenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate (PubChem CID 18923170) has the molecular formula C22H13Cl3F3NO5S and a molecular weight of 566.77 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate.
| Compound Name | (2,4,6-trichlorophenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18923170 |
| Molecular Formula | C22H13Cl3F3NO5S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 564.95 |
| IUPAC Name | (2,4,6-trichlorophenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate |
| SMILES | C[n+]1c2ccccc2c(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)c2ccccc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H13Cl3NO2.CHF3O3S/c1-25-17-8-4-2-6-13(17)19(14-7-3-5-9-18(14)25)21(26)27-20-15(23)10-12(22)11-16(20)24;2-1(3,4)8(5,6)7/h2-11H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | DMBXOMKGVPTOEE-UHFFFAOYSA-M |
| XLogP | 6.05 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|