C24H17F4NO7S — CID 23358385
2-[9-(4-fluoro-2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate (PubChem CID 23358385) has the molecular formula C24H17F4NO7S and a molecular weight of 539.46 g/mol. Its IUPAC name is 2-[9-(4-fluoro-2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate.
| Compound Name | 2-[9-(4-fluoro-2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23358385 |
| Molecular Formula | C24H17F4NO7S |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2-[9-(4-fluoro-2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate |
| SMILES | Cc1cc(F)ccc1OC(=O)c1c2ccccc2[n+](CC(=O)O)c2ccccc12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H16FNO4.CHF3O3S/c1-14-12-15(24)10-11-20(14)29-23(28)22-16-6-2-4-8-18(16)25(13-21(26)27)19-9-5-3-7-17(19)22;2-1(3,4)8(5,6)7/h2-12H,13H2,1H3;(H,5,6,7) |
| InChIKey | BFMSJSSPTMPRDE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|