C27H17ClF3NO7S — CID 173239809
10-(carboxymethyl)-1-(2-chloronaphthalen-1-yl)acridin-10-ium-9-carboxylic acid;trifluoromethanesulfonate (PubChem CID 173239809) has the molecular formula C27H17ClF3NO7S and a molecular weight of 591.95 g/mol. Its IUPAC name is 10-(carboxymethyl)-1-(2-chloronaphthalen-1-yl)acridin-10-ium-9-carboxylic acid;trifluoromethanesulfonate.
| Compound Name | 10-(carboxymethyl)-1-(2-chloronaphthalen-1-yl)acridin-10-ium-9-carboxylic acid;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 173239809 |
| Molecular Formula | C27H17ClF3NO7S |
| Molecular Weight | 591.95 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | 10-(carboxymethyl)-1-(2-chloronaphthalen-1-yl)acridin-10-ium-9-carboxylic acid;trifluoromethanesulfonate |
| SMILES | O=C(O)C[n+]1c2ccccc2c(C(=O)O)c2c(-c3c(Cl)ccc4ccccc34)cccc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C26H16ClNO4.CHF3O3S/c27-19-13-12-15-6-1-2-7-16(15)23(19)18-9-5-11-21-24(18)25(26(31)32)17-8-3-4-10-20(17)28(21)14-22(29)30;2-1(3,4)8(5,6)7/h1-13H,14H2,(H-,29,30,31,32);(H,5,6,7) |
| InChIKey | GPXRNOTVQOTLMV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 135.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.95 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|