About 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 18947404) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Analyze 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 18947404) is 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is CC1=CC(=O)C2OCC1O2.
What is the InChIKey of 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is GKZKCTWRLLFBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-4-2-5(8)7-9-3-6(4)10-7/h2,6-7H,3H2,1H3.
What are the key properties of 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 140.14 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 18947404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).