C24H50O8 — CID 18965600
1,2,5,6-tetrakis(tert-butylperoxy)-2,5-dimethylhexane (PubChem CID 18965600) has the molecular formula C24H50O8 and a molecular weight of 466.66 g/mol. Its IUPAC name is 1,2,5,6-tetrakis(tert-butylperoxy)-2,5-dimethylhexane.
| Compound Name | 1,2,5,6-tetrakis(tert-butylperoxy)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 18965600 |
| Molecular Formula | C24H50O8 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 1,2,5,6-tetrakis(tert-butylperoxy)-2,5-dimethylhexane |
| SMILES | CC(C)(C)OOCC(C)(CCC(C)(COOC(C)(C)C)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C24H50O8/c1-19(2,3)27-25-17-23(13,31-29-21(7,8)9)15-16-24(14,32-30-22(10,11)12)18-26-28-20(4,5)6/h15-18H2,1-14H3 |
| InChIKey | YPWFYYFUJZWGPL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|