About 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol
2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol (PubChem CID 18968497) has the molecular formula C22H50O3
and a molecular weight of 362.64 g/mol. Its IUPAC name is 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol.
Molecular Properties
| Compound Name | 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol |
| PubChem CID | 18968497 |
| Molecular Formula | C22H50O3 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.38 |
| IUPAC Name | 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol |
| SMILES | CCC(CC)CO.CCCC(C)C(C)O.CCCCC(C)(O)CCC |
| InChI | InChI=1S/C9H20O.C7H16O.C6H14O/c1-4-6-8-9(3,10)7-5-2;1-4-5-6(2)7(3)8;1-3-6(4-2)5-7/h10H,4-8H2,1-3H3;6-8H,4-5H2,1-3H3;6-7H,3-5H2,1-2H3 |
| InChIKey | PUJKRZKABAKAAG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol?
The IUPAC name of 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol (CID 18968497) is 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol.
What is the SMILES notation for 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol?
The canonical SMILES for 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol is CCC(CC)CO.CCCC(C)C(C)O.CCCCC(C)(O)CCC.
What is the InChIKey of 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol?
The InChIKey is PUJKRZKABAKAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O.C7H16O.C6H14O/c1-4-6-8-9(3,10)7-5-2;1-4-5-6(2)7(3)8;1-3-6(4-2)5-7/h10H,4-8H2,1-3H3;6-8H,4-5H2,1-3H3;6-7H,3-5H2,1-2H3.
What are the key properties of 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol?
2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol has a molecular weight of 362.64 g/mol, XLogP of 5.95, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutan-1-ol;3-methylhexan-2-ol;4-methyloctan-4-ol is sourced from PubChem (CID 18968497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).