C21H20F3N3O2 — CID 18971914
N-[6-(aminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-3-(trifluoromethoxy)benzamide (PubChem CID 18971914) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[6-(aminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-3-(trifluoromethoxy)benzamide.
| Compound Name | N-[6-(aminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18971914 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[6-(aminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-3-(trifluoromethoxy)benzamide |
| SMILES | NCC1CCc2[nH]c3ccc(NC(=O)c4cccc(OC(F)(F)F)c4)cc3c2C1 |
| InChI | InChI=1S/C21H20F3N3O2/c22-21(23,24)29-15-3-1-2-13(9-15)20(28)26-14-5-7-19-17(10-14)16-8-12(11-25)4-6-18(16)27-19/h1-3,5,7,9-10,12,27H,4,6,8,11,25H2,(H,26,28) |
| InChIKey | SLUNGOYYYDRITL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|