C28H32FN5O2 — CID 18971918
(3-fluorophenyl) N-[6-[[2-(1-propan-2-ylpyrazol-4-yl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate (PubChem CID 18971918) has the molecular formula C28H32FN5O2 and a molecular weight of 489.60 g/mol. Its IUPAC name is (3-fluorophenyl) N-[6-[[2-(1-propan-2-ylpyrazol-4-yl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate.
| Compound Name | (3-fluorophenyl) N-[6-[[2-(1-propan-2-ylpyrazol-4-yl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate |
|---|---|
| PubChem CID | 18971918 |
| Molecular Formula | C28H32FN5O2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (3-fluorophenyl) N-[6-[[2-(1-propan-2-ylpyrazol-4-yl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate |
| SMILES | CC(C)n1cc(CCNCC2CCc3[nH]c4ccc(NC(=O)Oc5cccc(F)c5)cc4c3C2)cn1 |
| InChI | InChI=1S/C28H32FN5O2/c1-18(2)34-17-20(16-31-34)10-11-30-15-19-6-8-26-24(12-19)25-14-22(7-9-27(25)33-26)32-28(35)36-23-5-3-4-21(29)13-23/h3-5,7,9,13-14,16-19,30,33H,6,8,10-12,15H2,1-2H3,(H,32,35) |
| InChIKey | PTUHBWDYGGVCMR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|