C21H31N3O — CID 18972117
N-[6-(butylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]butanamide (PubChem CID 18972117) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[6-(butylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]butanamide.
| Compound Name | N-[6-(butylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]butanamide |
|---|---|
| PubChem CID | 18972117 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | N-[6-(butylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]butanamide |
| SMILES | CCCCNCC1CCc2[nH]c3ccc(NC(=O)CCC)cc3c2C1 |
| InChI | InChI=1S/C21H31N3O/c1-3-5-11-22-14-15-7-9-19-17(12-15)18-13-16(8-10-20(18)24-19)23-21(25)6-4-2/h8,10,13,15,22,24H,3-7,9,11-12,14H2,1-2H3,(H,23,25) |
| InChIKey | NXKOGWPAWZBBBR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|