C22H23ClN2O — CID 18972114
(3-chlorophenyl)-[6-(ethylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone (PubChem CID 18972114) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is (3-chlorophenyl)-[6-(ethylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone.
| Compound Name | (3-chlorophenyl)-[6-(ethylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone |
|---|---|
| PubChem CID | 18972114 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3-chlorophenyl)-[6-(ethylaminomethyl)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]methanone |
| SMILES | CCNCC1CCc2[nH]c3ccc(C(=O)c4cccc(Cl)c4)cc3c2C1 |
| InChI | InChI=1S/C22H23ClN2O/c1-2-24-13-14-6-8-20-18(10-14)19-12-16(7-9-21(19)25-20)22(26)15-4-3-5-17(23)11-15/h3-5,7,9,11-12,14,24-25H,2,6,8,10,13H2,1H3 |
| InChIKey | ONVARTBUEFIJHA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|