C27H34BrN3O2 — CID 18971998
N-[6-[[1-(4-bromophenyl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-2-butoxyacetamide (PubChem CID 18971998) has the molecular formula C27H34BrN3O2 and a molecular weight of 512.49 g/mol. Its IUPAC name is N-[6-[[1-(4-bromophenyl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-2-butoxyacetamide.
| Compound Name | N-[6-[[1-(4-bromophenyl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-2-butoxyacetamide |
|---|---|
| PubChem CID | 18971998 |
| Molecular Formula | C27H34BrN3O2 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N-[6-[[1-(4-bromophenyl)ethylamino]methyl]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-2-butoxyacetamide |
| SMILES | CCCCOCC(=O)Nc1ccc2[nH]c3c(c2c1)CC(CNC(C)c1ccc(Br)cc1)CC3 |
| InChI | InChI=1S/C27H34BrN3O2/c1-3-4-13-33-17-27(32)30-22-10-12-26-24(15-22)23-14-19(5-11-25(23)31-26)16-29-18(2)20-6-8-21(28)9-7-20/h6-10,12,15,18-19,29,31H,3-5,11,13-14,16-17H2,1-2H3,(H,30,32) |
| InChIKey | WAHGWNJURCHQQG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|